ChemNet > CAS > 175137-21-0 4-chloro-7-methylthieno[3,2-d]pyrimidine
175137-21-0 4-chloro-7-methylthieno[3,2-d]pyrimidine
produktnavn |
4-chloro-7-methylthieno[3,2-d]pyrimidine |
Molekylær Formel |
C7H5ClN2S |
Molekylvekt |
184.646 |
InChI |
InChI=1/C7H5ClN2S/c1-4-2-11-6-5(4)9-3-10-7(6)8/h2-3H,1H3 |
CAS-nummer |
175137-21-0 |
Molecular Structure |
|
Tetthet |
1.445g/cm3 |
Smeltepunkt |
124℃ |
Kokepunkt |
301.3°C at 760 mmHg |
Brytningsindeks |
1.682 |
Flammepunktet |
136°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|